About N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide
N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide (PubChem CID 173118403) has the molecular formula C18H19IN4S2
and a molecular weight of 482.42 g/mol. Its IUPAC name is N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide.
Molecular Properties
| Compound Name | N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide |
| PubChem CID | 173118403 |
| Molecular Formula | C18H19IN4S2 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide |
| SMILES | CCCCn1c(=NNc2nc3ccccc3s2)sc2ccccc21.I |
| InChI | InChI=1S/C18H18N4S2.HI/c1-2-3-12-22-14-9-5-7-11-16(14)24-18(22)21-20-17-19-13-8-4-6-10-15(13)23-17;/h4-11H,2-3,12H2,1H3,(H,19,20);1H |
| InChIKey | BOUQSJQVQMSUJT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide?
The IUPAC name of N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide (CID 173118403) is N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide.
What is the SMILES notation for N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide?
The canonical SMILES for N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide is CCCCn1c(=NNc2nc3ccccc3s2)sc2ccccc21.I.
What is the InChIKey of N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide?
The InChIKey is BOUQSJQVQMSUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4S2.HI/c1-2-3-12-22-14-9-5-7-11-16(14)24-18(22)21-20-17-19-13-8-4-6-10-15(13)23-17;/h4-11H,2-3,12H2,1H3,(H,19,20);1H.
What are the key properties of N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide?
N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide has a molecular weight of 482.42 g/mol, XLogP of 5.66, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-butyl-1,3-benzothiazol-2-ylidene)amino]-1,3-benzothiazol-2-amine;hydroiodide is sourced from PubChem (CID 173118403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).