About zinc;but-2-enenitrile;bromide
zinc;but-2-enenitrile;bromide (PubChem CID 173118440) has the molecular formula C4H4BrNZn
and a molecular weight of 211.38 g/mol. Its IUPAC name is zinc;but-2-enenitrile;bromide.
Molecular Properties
| Compound Name | zinc;but-2-enenitrile;bromide |
| PubChem CID | 173118440 |
| Molecular Formula | C4H4BrNZn |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 208.88 |
| IUPAC Name | zinc;but-2-enenitrile;bromide |
| SMILES | [Br-].[CH2-]C=CC#N.[Zn+2] |
| InChI | InChI=1S/C4H4N.BrH.Zn/c1-2-3-4-5;;/h2-3H,1H2;1H;/q-1;;+2/p-1 |
| InChIKey | NFXKBXYHSFPCKO-UHFFFAOYSA-M |
| XLogP | -2.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;but-2-enenitrile;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;but-2-enenitrile;bromide?
The IUPAC name of zinc;but-2-enenitrile;bromide (CID 173118440) is zinc;but-2-enenitrile;bromide.
What is the SMILES notation for zinc;but-2-enenitrile;bromide?
The canonical SMILES for zinc;but-2-enenitrile;bromide is [Br-].[CH2-]C=CC#N.[Zn+2].
What is the InChIKey of zinc;but-2-enenitrile;bromide?
The InChIKey is NFXKBXYHSFPCKO-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H4N.BrH.Zn/c1-2-3-4-5;;/h2-3H,1H2;1H;/q-1;;+2/p-1.
What are the key properties of zinc;but-2-enenitrile;bromide?
zinc;but-2-enenitrile;bromide has a molecular weight of 211.38 g/mol, XLogP of -2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;but-2-enenitrile;bromide is sourced from PubChem (CID 173118440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).