About sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde
sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde (PubChem CID 173118852) has the molecular formula C5H6NNaO3
and a molecular weight of 151.10 g/mol. Its IUPAC name is sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 173118852 |
| Molecular Formula | C5H6NNaO3 |
| Molecular Weight | 151.10 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde |
| SMILES | Cc1nc(C=O)c(O)o1.[H-].[Na+] |
| InChI | InChI=1S/C5H5NO3.Na.H/c1-3-6-4(2-7)5(8)9-3;;/h2,8H,1H3;;/q;+1;-1 |
| InChIKey | RZDFAYQNYAQCFI-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.10 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde?
The IUPAC name of sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde (CID 173118852) is sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde is Cc1nc(C=O)c(O)o1.[H-].[Na+].
What is the InChIKey of sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde?
The InChIKey is RZDFAYQNYAQCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3.Na.H/c1-3-6-4(2-7)5(8)9-3;;/h2,8H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde?
sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde has a molecular weight of 151.10 g/mol, XLogP of -2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;5-hydroxy-2-methyl-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 173118852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).