About N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline
N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline (PubChem CID 173119338) has the molecular formula C20H21NO
and a molecular weight of 291.39 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline.
Molecular Properties
| Compound Name | N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline |
| PubChem CID | 173119338 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline |
| SMILES | CN(C)c1ccc(C2=CC(Oc3ccccc3)=CCC2)cc1 |
| InChI | InChI=1S/C20H21NO/c1-21(2)18-13-11-16(12-14-18)17-7-6-10-20(15-17)22-19-8-4-3-5-9-19/h3-5,8-15H,6-7H2,1-2H3 |
| InChIKey | GIASEQZNZNEGHU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline?
The IUPAC name of N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline (CID 173119338) is N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline.
What is the SMILES notation for N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline?
The canonical SMILES for N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline is CN(C)c1ccc(C2=CC(Oc3ccccc3)=CCC2)cc1.
What is the InChIKey of N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline?
The InChIKey is GIASEQZNZNEGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO/c1-21(2)18-13-11-16(12-14-18)17-7-6-10-20(15-17)22-19-8-4-3-5-9-19/h3-5,8-15H,6-7H2,1-2H3.
What are the key properties of N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline?
N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline has a molecular weight of 291.39 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-(3-phenoxycyclohexa-1,3-dien-1-yl)aniline is sourced from PubChem (CID 173119338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).