About [(Z)-prop-1-enyl] 2-sulfanylpropanoate
[(Z)-prop-1-enyl] 2-sulfanylpropanoate (PubChem CID 173119647) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is [(Z)-prop-1-enyl] 2-sulfanylpropanoate.
Molecular Properties
| Compound Name | [(Z)-prop-1-enyl] 2-sulfanylpropanoate |
| PubChem CID | 173119647 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | [(Z)-prop-1-enyl] 2-sulfanylpropanoate |
| SMILES | C/C=C\OC(=O)C(C)S |
| InChI | InChI=1S/C6H10O2S/c1-3-4-8-6(7)5(2)9/h3-5,9H,1-2H3/b4-3- |
| InChIKey | QIBKHZCCRONPRF-ARJAWSKDSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-prop-1-enyl] 2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-prop-1-enyl] 2-sulfanylpropanoate?
The IUPAC name of [(Z)-prop-1-enyl] 2-sulfanylpropanoate (CID 173119647) is [(Z)-prop-1-enyl] 2-sulfanylpropanoate.
What is the SMILES notation for [(Z)-prop-1-enyl] 2-sulfanylpropanoate?
The canonical SMILES for [(Z)-prop-1-enyl] 2-sulfanylpropanoate is C/C=C\OC(=O)C(C)S.
What is the InChIKey of [(Z)-prop-1-enyl] 2-sulfanylpropanoate?
The InChIKey is QIBKHZCCRONPRF-ARJAWSKDSA-N. The full InChI is InChI=1S/C6H10O2S/c1-3-4-8-6(7)5(2)9/h3-5,9H,1-2H3/b4-3-.
What are the key properties of [(Z)-prop-1-enyl] 2-sulfanylpropanoate?
[(Z)-prop-1-enyl] 2-sulfanylpropanoate has a molecular weight of 146.21 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-prop-1-enyl] 2-sulfanylpropanoate is sourced from PubChem (CID 173119647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).