About 2-ethyl-4-iminobutanal
2-ethyl-4-iminobutanal (PubChem CID 173121317) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-ethyl-4-iminobutanal.
Molecular Properties
| Compound Name | 2-ethyl-4-iminobutanal |
| PubChem CID | 173121317 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-ethyl-4-iminobutanal |
| SMILES | [H]/N=C/CC(C=O)CC |
| InChI | InChI=1S/C6H11NO/c1-2-6(5-8)3-4-7/h4-7H,2-3H2,1H3/b7-4+ |
| InChIKey | WUAUKHJFQOVHNR-QPJJXVBHSA-N |
| XLogP | 1.25 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-iminobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-iminobutanal?
The IUPAC name of 2-ethyl-4-iminobutanal (CID 173121317) is 2-ethyl-4-iminobutanal.
What is the SMILES notation for 2-ethyl-4-iminobutanal?
The canonical SMILES for 2-ethyl-4-iminobutanal is [H]/N=C/CC(C=O)CC.
What is the InChIKey of 2-ethyl-4-iminobutanal?
The InChIKey is WUAUKHJFQOVHNR-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H11NO/c1-2-6(5-8)3-4-7/h4-7H,2-3H2,1H3/b7-4+.
What are the key properties of 2-ethyl-4-iminobutanal?
2-ethyl-4-iminobutanal has a molecular weight of 113.16 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-iminobutanal is sourced from PubChem (CID 173121317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).