About 1-(1H-inden-2-yl)-1,3a-dihydroazulene
1-(1H-inden-2-yl)-1,3a-dihydroazulene (PubChem CID 173121614) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-(1H-inden-2-yl)-1,3a-dihydroazulene.
Molecular Properties
| Compound Name | 1-(1H-inden-2-yl)-1,3a-dihydroazulene |
| PubChem CID | 173121614 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(1H-inden-2-yl)-1,3a-dihydroazulene |
| SMILES | C1=CC=C2C(C=C1)C=CC2C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C19H16/c1-2-6-14-10-11-19(18(14)9-3-1)17-12-15-7-4-5-8-16(15)13-17/h1-12,14,19H,13H2 |
| InChIKey | SVCFQGJJTITVBI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-inden-2-yl)-1,3a-dihydroazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-inden-2-yl)-1,3a-dihydroazulene?
The IUPAC name of 1-(1H-inden-2-yl)-1,3a-dihydroazulene (CID 173121614) is 1-(1H-inden-2-yl)-1,3a-dihydroazulene.
What is the SMILES notation for 1-(1H-inden-2-yl)-1,3a-dihydroazulene?
The canonical SMILES for 1-(1H-inden-2-yl)-1,3a-dihydroazulene is C1=CC=C2C(C=C1)C=CC2C1=Cc2ccccc2C1.
What is the InChIKey of 1-(1H-inden-2-yl)-1,3a-dihydroazulene?
The InChIKey is SVCFQGJJTITVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16/c1-2-6-14-10-11-19(18(14)9-3-1)17-12-15-7-4-5-8-16(15)13-17/h1-12,14,19H,13H2.
What are the key properties of 1-(1H-inden-2-yl)-1,3a-dihydroazulene?
1-(1H-inden-2-yl)-1,3a-dihydroazulene has a molecular weight of 244.34 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-inden-2-yl)-1,3a-dihydroazulene is sourced from PubChem (CID 173121614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).