About 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid
2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid (PubChem CID 173122469) has the molecular formula C23H30O3Si
and a molecular weight of 382.58 g/mol. Its IUPAC name is 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid |
| PubChem CID | 173122469 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid |
| SMILES | CC(C)(C)[C@@H]1CCC[C@]1(CC(=O)O)O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O3Si/c1-22(2,3)20-15-10-16-23(20,17-21(24)25)26-27(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,20,27H,10,15-17H2,1-3H3,(H,24,25)/t20-,23+/m0/s1 |
| InChIKey | GUADXAKSTOMMKK-NZQKXSOJSA-N |
| XLogP | 3.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid?
The IUPAC name of 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid (CID 173122469) is 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid.
What is the SMILES notation for 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid?
The canonical SMILES for 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid is CC(C)(C)[C@@H]1CCC[C@]1(CC(=O)O)O[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid?
The InChIKey is GUADXAKSTOMMKK-NZQKXSOJSA-N. The full InChI is InChI=1S/C23H30O3Si/c1-22(2,3)20-15-10-16-23(20,17-21(24)25)26-27(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,20,27H,10,15-17H2,1-3H3,(H,24,25)/t20-,23+/m0/s1.
What are the key properties of 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid?
2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid has a molecular weight of 382.58 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S)-2-tert-butyl-1-diphenylsilyloxycyclopentyl]acetic acid is sourced from PubChem (CID 173122469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).