About (9Z)-5,8-dihydrobenzo[8]annulene
(9Z)-5,8-dihydrobenzo[8]annulene (PubChem CID 173122574) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is (9Z)-5,8-dihydrobenzo[8]annulene.
Molecular Properties
| Compound Name | (9Z)-5,8-dihydrobenzo[8]annulene |
| PubChem CID | 173122574 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (9Z)-5,8-dihydrobenzo[8]annulene |
| SMILES | C1=CCc2ccccc2/C=C\C1 |
| InChI | InChI=1S/C12H12/c1-2-4-8-12-10-6-5-9-11(12)7-3-1/h1,3-6,8-10H,2,7H2/b3-1?,8-4- |
| InChIKey | OVJZFPAXXCRCJB-JGKYKJABSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-5,8-dihydrobenzo[8]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-5,8-dihydrobenzo[8]annulene?
The IUPAC name of (9Z)-5,8-dihydrobenzo[8]annulene (CID 173122574) is (9Z)-5,8-dihydrobenzo[8]annulene.
What is the SMILES notation for (9Z)-5,8-dihydrobenzo[8]annulene?
The canonical SMILES for (9Z)-5,8-dihydrobenzo[8]annulene is C1=CCc2ccccc2/C=C\C1.
What is the InChIKey of (9Z)-5,8-dihydrobenzo[8]annulene?
The InChIKey is OVJZFPAXXCRCJB-JGKYKJABSA-N. The full InChI is InChI=1S/C12H12/c1-2-4-8-12-10-6-5-9-11(12)7-3-1/h1,3-6,8-10H,2,7H2/b3-1?,8-4-.
What are the key properties of (9Z)-5,8-dihydrobenzo[8]annulene?
(9Z)-5,8-dihydrobenzo[8]annulene has a molecular weight of 156.23 g/mol, XLogP of 3.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-5,8-dihydrobenzo[8]annulene is sourced from PubChem (CID 173122574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).