C10H20N2O3 — CID 173122588
2-amino-N-(1,3-dioxolan-2-yl)-N,3,3-trimethylbutanamide (PubChem CID 173122588) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-amino-N-(1,3-dioxolan-2-yl)-N,3,3-trimethylbutanamide.
| Compound Name | 2-amino-N-(1,3-dioxolan-2-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 173122588 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-amino-N-(1,3-dioxolan-2-yl)-N,3,3-trimethylbutanamide |
| SMILES | CN(C(=O)C(N)C(C)(C)C)C1OCCO1 |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,3)7(11)8(13)12(4)9-14-5-6-15-9/h7,9H,5-6,11H2,1-4H3 |
| InChIKey | WPMDMHIEWDTMQO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |