C23H25FN4O3 — CID 173122785
N-[2-(butylamino)-2-oxoethyl]-3-[2-(4-fluorophenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide (PubChem CID 173122785) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[2-(butylamino)-2-oxoethyl]-3-[2-(4-fluorophenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide.
| Compound Name | N-[2-(butylamino)-2-oxoethyl]-3-[2-(4-fluorophenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 173122785 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[2-(butylamino)-2-oxoethyl]-3-[2-(4-fluorophenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide |
| SMILES | CCCCNC(=O)CNC(=O)c1ccc2n[nH]c(C=Cc3ccc(F)cc3)c2c1OC |
| InChI | InChI=1S/C23H25FN4O3/c1-3-4-13-25-20(29)14-26-23(30)17-10-12-19-21(22(17)31-2)18(27-28-19)11-7-15-5-8-16(24)9-6-15/h5-12H,3-4,13-14H2,1-2H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | LYJSGMZOOQWBKM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|