C25H22FN3O3 — CID 173122854
N-benzyl-3-[2-(3-fluoro-4-methoxyphenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide (PubChem CID 173122854) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is N-benzyl-3-[2-(3-fluoro-4-methoxyphenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide.
| Compound Name | N-benzyl-3-[2-(3-fluoro-4-methoxyphenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 173122854 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-benzyl-3-[2-(3-fluoro-4-methoxyphenyl)ethenyl]-4-methoxy-2H-indazole-5-carboxamide |
| SMILES | COc1ccc(C=Cc2[nH]nc3ccc(C(=O)NCc4ccccc4)c(OC)c23)cc1F |
| InChI | InChI=1S/C25H22FN3O3/c1-31-22-13-9-16(14-19(22)26)8-11-20-23-21(29-28-20)12-10-18(24(23)32-2)25(30)27-15-17-6-4-3-5-7-17/h3-14H,15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | GJVBNYXBAOLUSV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |