About N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide
N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide (PubChem CID 173123151) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide.
Molecular Properties
| Compound Name | N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide |
| PubChem CID | 173123151 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide |
| SMILES | CCC(=O)NC1CCN(c2ncncn2)CC1 |
| InChI | InChI=1S/C11H17N5O/c1-2-10(17)15-9-3-5-16(6-4-9)11-13-7-12-8-14-11/h7-9H,2-6H2,1H3,(H,15,17) |
| InChIKey | KBZAWFVSNWYAKJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide?
The IUPAC name of N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide (CID 173123151) is N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide.
What is the SMILES notation for N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide?
The canonical SMILES for N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide is CCC(=O)NC1CCN(c2ncncn2)CC1.
What is the InChIKey of N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide?
The InChIKey is KBZAWFVSNWYAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-2-10(17)15-9-3-5-16(6-4-9)11-13-7-12-8-14-11/h7-9H,2-6H2,1H3,(H,15,17).
What are the key properties of N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide?
N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide has a molecular weight of 235.29 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]propanamide is sourced from PubChem (CID 173123151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).