C23H33N3O4 — CID 17312324
1-cyclohexyl-N-[2-(3-ethoxypropylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 17312324) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-cyclohexyl-N-[2-(3-ethoxypropylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-N-[2-(3-ethoxypropylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17312324 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-cyclohexyl-N-[2-(3-ethoxypropylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOCCCNC(=O)c1ccccc1NC(=O)C1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C23H33N3O4/c1-2-30-14-8-13-24-23(29)19-11-6-7-12-20(19)25-22(28)17-15-21(27)26(16-17)18-9-4-3-5-10-18/h6-7,11-12,17-18H,2-5,8-10,13-16H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | TVMGCHSMUSSHRC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|