C40H40N4O — CID 173123737
1-[(1Z,14Z)-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,19,23,24-tetrahydro-16H-porphyrin-2-yl]ethanone (PubChem CID 173123737) has the molecular formula C40H40N4O and a molecular weight of 592.79 g/mol. Its IUPAC name is 1-[(1Z,14Z)-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,19,23,24-tetrahydro-16H-porphyrin-2-yl]ethanone.
| Compound Name | 1-[(1Z,14Z)-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,19,23,24-tetrahydro-16H-porphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 173123737 |
| Molecular Formula | C40H40N4O |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | 1-[(1Z,14Z)-17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18,19,23,24-tetrahydro-16H-porphyrin-2-yl]ethanone |
| SMILES | CC(=O)C1=CC2=N/C1=C\C1CC(C)(C)C(/C=c3/ccc([nH]3)=C(c3ccc(C)cc3)C3=NC(=C2c2c(C)cc(C)cc2C)C=C3)N1 |
| InChI | InChI=1S/C40H40N4O/c1-22-8-10-27(11-9-22)38-31-13-12-28(41-31)19-36-40(6,7)21-29(42-36)18-34-30(26(5)45)20-35(44-34)39(33-15-14-32(38)43-33)37-24(3)16-23(2)17-25(37)4/h8-20,29,36,41-42H,21H2,1-7H3/b28-19-,34-18-,38-31?,39-33? |
| InChIKey | QQJNBUVLPFUNDG-MQXYFIAMSA-N |
| XLogP | 6.27 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |