hydron;phosphorous acid

H5O3P+2 — CID 173124088

IUPAChydron;phosphorous acid
SMILESOP(O)O.[H+].[H+]
InChIInChI=1S/H3O3P/c1-4(2)3/h1-3H/p+2
InChIKeyOJMIONKXNSYLSR-UHFFFAOYSA-P
MW84.01 g/mol
LogP-0.58
Rot. Bonds

About hydron;phosphorous acid

hydron;phosphorous acid (PubChem CID 173124088) has the molecular formula H5O3P+2 and a molecular weight of 84.01 g/mol. Its IUPAC name is hydron;phosphorous acid.

Molecular Properties

Compound Namehydron;phosphorous acid
PubChem CID173124088
Molecular FormulaH5O3P+2
Molecular Weight84.01 g/mol
Exact Mass84.00
IUPAC Namehydron;phosphorous acid
SMILESOP(O)O.[H+].[H+]
InChIInChI=1S/H3O3P/c1-4(2)3/h1-3H/p+2
InChIKeyOJMIONKXNSYLSR-UHFFFAOYSA-P
XLogP-0.58
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms4
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50084.01
LogP ≤ 5-0.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze hydron;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydron;phosphorous acid?
The IUPAC name of hydron;phosphorous acid (CID 173124088) is hydron;phosphorous acid.
What is the SMILES notation for hydron;phosphorous acid?
The canonical SMILES for hydron;phosphorous acid is OP(O)O.[H+].[H+].
What is the InChIKey of hydron;phosphorous acid?
The InChIKey is OJMIONKXNSYLSR-UHFFFAOYSA-P. The full InChI is InChI=1S/H3O3P/c1-4(2)3/h1-3H/p+2.
What are the key properties of hydron;phosphorous acid?
hydron;phosphorous acid has a molecular weight of 84.01 g/mol, XLogP of -0.58, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;phosphorous acid is sourced from PubChem (CID 173124088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).