C23H30F3NO2Si — CID 173124325
N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 173124325) has the molecular formula C23H30F3NO2Si and a molecular weight of 437.58 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 173124325 |
| Molecular Formula | C23H30F3NO2Si |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | CC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C23H30F3NO2Si/c1-6-18(27(5)21(28)23(24,25)26)17-29-30(22(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18H,6,17H2,1-5H3/t18-/m0/s1 |
| InChIKey | KERPRXIIKNJAAR-SFHVURJKSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|