About iridium;2-methylidenebenzimidazole
iridium;2-methylidenebenzimidazole (PubChem CID 173124515) has the molecular formula C8H6IrN2
and a molecular weight of 322.37 g/mol. Its IUPAC name is iridium;2-methylidenebenzimidazole.
Molecular Properties
| Compound Name | iridium;2-methylidenebenzimidazole |
| PubChem CID | 173124515 |
| Molecular Formula | C8H6IrN2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | iridium;2-methylidenebenzimidazole |
| SMILES | C=C1N=c2ccccc2=N1.[Ir] |
| InChI | InChI=1S/C8H6N2.Ir/c1-6-9-7-4-2-3-5-8(7)10-6;/h2-5H,1H2; |
| InChIKey | PKBPPJBPOXBBAZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze iridium;2-methylidenebenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-methylidenebenzimidazole?
The IUPAC name of iridium;2-methylidenebenzimidazole (CID 173124515) is iridium;2-methylidenebenzimidazole.
What is the SMILES notation for iridium;2-methylidenebenzimidazole?
The canonical SMILES for iridium;2-methylidenebenzimidazole is C=C1N=c2ccccc2=N1.[Ir].
What is the InChIKey of iridium;2-methylidenebenzimidazole?
The InChIKey is PKBPPJBPOXBBAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.Ir/c1-6-9-7-4-2-3-5-8(7)10-6;/h2-5H,1H2;.
What are the key properties of iridium;2-methylidenebenzimidazole?
iridium;2-methylidenebenzimidazole has a molecular weight of 322.37 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-methylidenebenzimidazole is sourced from PubChem (CID 173124515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).