About (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane
(6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane (PubChem CID 173124814) has the molecular formula C16H30O2Si
and a molecular weight of 282.50 g/mol. Its IUPAC name is (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane |
| PubChem CID | 173124814 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane |
| SMILES | COC1=CCCC=C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30O2Si/c1-12(2)19(13(3)4,14(5)6)18-16-11-9-8-10-15(16)17-7/h10-14H,8-9H2,1-7H3 |
| InChIKey | YHOWIONXGCZEPK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane?
The IUPAC name of (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane (CID 173124814) is (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane.
What is the SMILES notation for (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane?
The canonical SMILES for (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane is COC1=CCCC=C1O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane?
The InChIKey is YHOWIONXGCZEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2Si/c1-12(2)19(13(3)4,14(5)6)18-16-11-9-8-10-15(16)17-7/h10-14H,8-9H2,1-7H3.
What are the key properties of (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane?
(6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane has a molecular weight of 282.50 g/mol, XLogP of 5.39, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methoxycyclohexa-1,5-dien-1-yl)oxy-tri(propan-2-yl)silane is sourced from PubChem (CID 173124814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).