About bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid
bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid (PubChem CID 173124873) has the molecular formula C30H30N4O4
and a molecular weight of 510.59 g/mol. Its IUPAC name is bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid.
Molecular Properties
| Compound Name | bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid |
| PubChem CID | 173124873 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid |
| SMILES | C(=C1/CCCc2ccccc21)\c1cnc[nH]1.C(=C1/CCCc2ccccc21)\c1cnc[nH]1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C14H14N2.C2H2O4/c2*1-2-7-14-11(4-1)5-3-6-12(14)8-13-9-15-10-16-13;3-1(4)2(5)6/h2*1-2,4,7-10H,3,5-6H2,(H,15,16);(H,3,4)(H,5,6)/b2*12-8-; |
| InChIKey | AFWRJLVRMAQBJM-BEDSROTNSA-N |
| XLogP | 5.73 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid?
The IUPAC name of bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid (CID 173124873) is bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid.
What is the SMILES notation for bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid?
The canonical SMILES for bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid is C(=C1/CCCc2ccccc21)\c1cnc[nH]1.C(=C1/CCCc2ccccc21)\c1cnc[nH]1.O=C(O)C(=O)O.
What is the InChIKey of bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid?
The InChIKey is AFWRJLVRMAQBJM-BEDSROTNSA-N. The full InChI is InChI=1S/2C14H14N2.C2H2O4/c2*1-2-7-14-11(4-1)5-3-6-12(14)8-13-9-15-10-16-13;3-1(4)2(5)6/h2*1-2,4,7-10H,3,5-6H2,(H,15,16);(H,3,4)(H,5,6)/b2*12-8-;.
What are the key properties of bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid?
bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid has a molecular weight of 510.59 g/mol, XLogP of 5.73, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-[(Z)-3,4-dihydro-2H-naphthalen-1-ylidenemethyl]-1H-imidazole);oxalic acid is sourced from PubChem (CID 173124873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).