About (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide
(2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide (PubChem CID 173125608) has the molecular formula C12H17F2N3O2
and a molecular weight of 273.28 g/mol. Its IUPAC name is (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide.
Molecular Properties
| Compound Name | (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide |
| PubChem CID | 173125608 |
| Molecular Formula | C12H17F2N3O2 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide |
| SMILES | C[C@@H](CC(F)(F)CCC(=O)NC1(C#N)CC1)C(N)=O |
| InChI | InChI=1S/C12H17F2N3O2/c1-8(10(16)19)6-12(13,14)3-2-9(18)17-11(7-15)4-5-11/h8H,2-6H2,1H3,(H2,16,19)(H,17,18)/t8-/m0/s1 |
| InChIKey | MDGFVHFJOHWMFO-QMMMGPOBSA-N |
| XLogP | 1.09 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide?
The IUPAC name of (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide (CID 173125608) is (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide.
What is the SMILES notation for (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide?
The canonical SMILES for (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide is C[C@@H](CC(F)(F)CCC(=O)NC1(C#N)CC1)C(N)=O.
What is the InChIKey of (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide?
The InChIKey is MDGFVHFJOHWMFO-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H17F2N3O2/c1-8(10(16)19)6-12(13,14)3-2-9(18)17-11(7-15)4-5-11/h8H,2-6H2,1H3,(H2,16,19)(H,17,18)/t8-/m0/s1.
What are the key properties of (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide?
(2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide has a molecular weight of 273.28 g/mol, XLogP of 1.09, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N'-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanediamide is sourced from PubChem (CID 173125608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).