About N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide
N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide (PubChem CID 173125656) has the molecular formula C14H22F2N4O2
and a molecular weight of 316.35 g/mol. Its IUPAC name is N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide.
Molecular Properties
| Compound Name | N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide |
| PubChem CID | 173125656 |
| Molecular Formula | C14H22F2N4O2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide |
| SMILES | CN1CCC(C#N)(NC(=O)CCC(F)(F)CCC(N)=O)CC1 |
| InChI | InChI=1S/C14H22F2N4O2/c1-20-8-6-13(10-17,7-9-20)19-12(22)3-5-14(15,16)4-2-11(18)21/h2-9H2,1H3,(H2,18,21)(H,19,22) |
| InChIKey | JWSHCMUOPYVTKW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide?
The IUPAC name of N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide (CID 173125656) is N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide.
What is the SMILES notation for N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide?
The canonical SMILES for N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide is CN1CCC(C#N)(NC(=O)CCC(F)(F)CCC(N)=O)CC1.
What is the InChIKey of N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide?
The InChIKey is JWSHCMUOPYVTKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N4O2/c1-20-8-6-13(10-17,7-9-20)19-12(22)3-5-14(15,16)4-2-11(18)21/h2-9H2,1H3,(H2,18,21)(H,19,22).
What are the key properties of N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide?
N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide has a molecular weight of 316.35 g/mol, XLogP of 0.77, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-cyano-1-methylpiperidin-4-yl)-4,4-difluoroheptanediamide is sourced from PubChem (CID 173125656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).