About 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide
1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide (PubChem CID 173126239) has the molecular formula C11H23N3O3Pd
and a molecular weight of 351.74 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide |
| PubChem CID | 173126239 |
| Molecular Formula | C11H23N3O3Pd |
| Molecular Weight | 351.74 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide |
| SMILES | CN(C)C(=O)C1CCN(C2CNC2)CC1.[OH-].[OH-].[Pd+2] |
| InChI | InChI=1S/C11H21N3O.2H2O.Pd/c1-13(2)11(15)9-3-5-14(6-4-9)10-7-12-8-10;;;/h9-10,12H,3-8H2,1-2H3;2*1H2;/q;;;+2/p-2 |
| InChIKey | FSGYLXRYJCKJKP-UHFFFAOYSA-L |
| XLogP | -0.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.74 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide?
The IUPAC name of 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide (CID 173126239) is 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide.
What is the SMILES notation for 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide?
The canonical SMILES for 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide is CN(C)C(=O)C1CCN(C2CNC2)CC1.[OH-].[OH-].[Pd+2].
What is the InChIKey of 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide?
The InChIKey is FSGYLXRYJCKJKP-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H21N3O.2H2O.Pd/c1-13(2)11(15)9-3-5-14(6-4-9)10-7-12-8-10;;;/h9-10,12H,3-8H2,1-2H3;2*1H2;/q;;;+2/p-2.
What are the key properties of 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide?
1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide has a molecular weight of 351.74 g/mol, XLogP of -0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-N,N-dimethylpiperidine-4-carboxamide;palladium(2+);dihydroxide is sourced from PubChem (CID 173126239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).