About diethoxysilane;N,N-dimethylethanamine
diethoxysilane;N,N-dimethylethanamine (PubChem CID 173126305) has the molecular formula C8H23NO2Si
and a molecular weight of 193.36 g/mol. Its IUPAC name is diethoxysilane;N,N-dimethylethanamine.
Molecular Properties
| Compound Name | diethoxysilane;N,N-dimethylethanamine |
| PubChem CID | 173126305 |
| Molecular Formula | C8H23NO2Si |
| Molecular Weight | 193.36 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | diethoxysilane;N,N-dimethylethanamine |
| SMILES | CCN(C)C.CCO[SiH2]OCC |
| InChI | InChI=1S/C4H11N.C4H12O2Si/c1-4-5(2)3;1-3-5-7-6-4-2/h4H2,1-3H3;3-4,7H2,1-2H3 |
| InChIKey | AJTNWENPJWTJAM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxysilane;N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxysilane;N,N-dimethylethanamine?
The IUPAC name of diethoxysilane;N,N-dimethylethanamine (CID 173126305) is diethoxysilane;N,N-dimethylethanamine.
What is the SMILES notation for diethoxysilane;N,N-dimethylethanamine?
The canonical SMILES for diethoxysilane;N,N-dimethylethanamine is CCN(C)C.CCO[SiH2]OCC.
What is the InChIKey of diethoxysilane;N,N-dimethylethanamine?
The InChIKey is AJTNWENPJWTJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.C4H12O2Si/c1-4-5(2)3;1-3-5-7-6-4-2/h4H2,1-3H3;3-4,7H2,1-2H3.
What are the key properties of diethoxysilane;N,N-dimethylethanamine?
diethoxysilane;N,N-dimethylethanamine has a molecular weight of 193.36 g/mol, XLogP of 0.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxysilane;N,N-dimethylethanamine is sourced from PubChem (CID 173126305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).