C21H31Cl2N2O7+ — CID 173127960
[(3R)-1-[(3,5-dichlorophenyl)methyl]-1-(oxan-4-yl)pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid (PubChem CID 173127960) has the molecular formula C21H31Cl2N2O7+ and a molecular weight of 494.39 g/mol. Its IUPAC name is [(3R)-1-[(3,5-dichlorophenyl)methyl]-1-(oxan-4-yl)pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid.
| Compound Name | [(3R)-1-[(3,5-dichlorophenyl)methyl]-1-(oxan-4-yl)pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 173127960 |
| Molecular Formula | C21H31Cl2N2O7+ |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [(3R)-1-[(3,5-dichlorophenyl)methyl]-1-(oxan-4-yl)pyrrolidin-1-ium-3-yl]methanamine;2,3-dihydroxybutanedioic acid |
| SMILES | NC[C@H]1CC[N+](Cc2cc(Cl)cc(Cl)c2)(C2CCOCC2)C1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C17H25Cl2N2O.C4H6O6/c18-15-7-14(8-16(19)9-15)12-21(4-1-13(10-20)11-21)17-2-5-22-6-3-17;5-1(3(7)8)2(6)4(9)10/h7-9,13,17H,1-6,10-12,20H2;1-2,5-6H,(H,7,8)(H,9,10)/q+1;/t13-,21?;/m1./s1 |
| InChIKey | VAQOQKYEMAQZQU-CHGWFMTHSA-N |
| XLogP | 1.35 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|