About 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide
5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide (PubChem CID 173127983) has the molecular formula C9H8ClF6NO2S2
and a molecular weight of 375.74 g/mol. Its IUPAC name is 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide |
| PubChem CID | 173127983 |
| Molecular Formula | C9H8ClF6NO2S2 |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Cl)s1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8ClF6NO2S2/c1-4(7(8(11,12)13)9(14,15)16)17-21(18,19)6-3-2-5(10)20-6/h2-4,7,17H,1H3/t4-/m0/s1 |
| InChIKey | RCHQFKBSVRAADV-BYPYZUCNSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide (CID 173127983) is 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide is C[C@H](NS(=O)(=O)c1ccc(Cl)s1)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide?
The InChIKey is RCHQFKBSVRAADV-BYPYZUCNSA-N. The full InChI is InChI=1S/C9H8ClF6NO2S2/c1-4(7(8(11,12)13)9(14,15)16)17-21(18,19)6-3-2-5(10)20-6/h2-4,7,17H,1H3/t4-/m0/s1.
What are the key properties of 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide?
5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide has a molecular weight of 375.74 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(2S)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 173127983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).