About (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane
(5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane (PubChem CID 173129222) has the molecular formula C14H30OSi2
and a molecular weight of 270.56 g/mol. Its IUPAC name is (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane.
Molecular Properties
| Compound Name | (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane |
| PubChem CID | 173129222 |
| Molecular Formula | C14H30OSi2 |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane |
| SMILES | C[SiH](C)OC(CCC#C[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H30OSi2/c1-14(2,3)13(15-16(4)5)11-9-10-12-17(6,7)8/h13,16H,9,11H2,1-8H3 |
| InChIKey | JWPNVNDXLOTWRR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane?
The IUPAC name of (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane (CID 173129222) is (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane.
What is the SMILES notation for (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane?
The canonical SMILES for (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane is C[SiH](C)OC(CCC#C[Si](C)(C)C)C(C)(C)C.
What is the InChIKey of (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane?
The InChIKey is JWPNVNDXLOTWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30OSi2/c1-14(2,3)13(15-16(4)5)11-9-10-12-17(6,7)8/h13,16H,9,11H2,1-8H3.
What are the key properties of (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane?
(5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane has a molecular weight of 270.56 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-dimethylsilyloxy-6,6-dimethylhept-1-ynyl)-trimethylsilane is sourced from PubChem (CID 173129222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).