About 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane
1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane (PubChem CID 173129383) has the molecular formula C14H25BrO
and a molecular weight of 289.26 g/mol. Its IUPAC name is 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane |
| PubChem CID | 173129383 |
| Molecular Formula | C14H25BrO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane |
| SMILES | CCC(C)(C)CC1OC2(CBr)CCC1CC2 |
| InChI | InChI=1S/C14H25BrO/c1-4-13(2,3)9-12-11-5-7-14(10-15,16-12)8-6-11/h11-12H,4-10H2,1-3H3 |
| InChIKey | AGBOKALRPMYOQO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane?
The IUPAC name of 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane (CID 173129383) is 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane.
What is the SMILES notation for 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane?
The canonical SMILES for 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane is CCC(C)(C)CC1OC2(CBr)CCC1CC2.
What is the InChIKey of 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane?
The InChIKey is AGBOKALRPMYOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25BrO/c1-4-13(2,3)9-12-11-5-7-14(10-15,16-12)8-6-11/h11-12H,4-10H2,1-3H3.
What are the key properties of 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane?
1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane has a molecular weight of 289.26 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-3-(2,2-dimethylbutyl)-2-oxabicyclo[2.2.2]octane is sourced from PubChem (CID 173129383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).