About diethoxysilane;4-methyl-2H-furan-5-one
diethoxysilane;4-methyl-2H-furan-5-one (PubChem CID 173129792) has the molecular formula C9H18O4Si
and a molecular weight of 218.32 g/mol. Its IUPAC name is diethoxysilane;4-methyl-2H-furan-5-one.
Molecular Properties
| Compound Name | diethoxysilane;4-methyl-2H-furan-5-one |
| PubChem CID | 173129792 |
| Molecular Formula | C9H18O4Si |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | diethoxysilane;4-methyl-2H-furan-5-one |
| SMILES | CC1=CCOC1=O.CCO[SiH2]OCC |
| InChI | InChI=1S/C5H6O2.C4H12O2Si/c1-4-2-3-7-5(4)6;1-3-5-7-6-4-2/h2H,3H2,1H3;3-4,7H2,1-2H3 |
| InChIKey | LXQXDYVOBBEJSS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxysilane;4-methyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxysilane;4-methyl-2H-furan-5-one?
The IUPAC name of diethoxysilane;4-methyl-2H-furan-5-one (CID 173129792) is diethoxysilane;4-methyl-2H-furan-5-one.
What is the SMILES notation for diethoxysilane;4-methyl-2H-furan-5-one?
The canonical SMILES for diethoxysilane;4-methyl-2H-furan-5-one is CC1=CCOC1=O.CCO[SiH2]OCC.
What is the InChIKey of diethoxysilane;4-methyl-2H-furan-5-one?
The InChIKey is LXQXDYVOBBEJSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2.C4H12O2Si/c1-4-2-3-7-5(4)6;1-3-5-7-6-4-2/h2H,3H2,1H3;3-4,7H2,1-2H3.
What are the key properties of diethoxysilane;4-methyl-2H-furan-5-one?
diethoxysilane;4-methyl-2H-furan-5-one has a molecular weight of 218.32 g/mol, XLogP of 0.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxysilane;4-methyl-2H-furan-5-one is sourced from PubChem (CID 173129792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).