About potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione
potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione (PubChem CID 173129835) has the molecular formula C4H7F3KN3S
and a molecular weight of 225.28 g/mol. Its IUPAC name is potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione.
Molecular Properties
| Compound Name | potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione |
| PubChem CID | 173129835 |
| Molecular Formula | C4H7F3KN3S |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione |
| SMILES | CN1C(=S)NNC1C(F)(F)F.[H-].[K+] |
| InChI | InChI=1S/C4H6F3N3S.K.H/c1-10-2(4(5,6)7)8-9-3(10)11;;/h2,8H,1H3,(H,9,11);;/q;+1;-1 |
| InChIKey | QUMQSJXAJYHQOR-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione?
The IUPAC name of potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione (CID 173129835) is potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione.
What is the SMILES notation for potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione?
The canonical SMILES for potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione is CN1C(=S)NNC1C(F)(F)F.[H-].[K+].
What is the InChIKey of potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione?
The InChIKey is QUMQSJXAJYHQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F3N3S.K.H/c1-10-2(4(5,6)7)8-9-3(10)11;;/h2,8H,1H3,(H,9,11);;/q;+1;-1.
What are the key properties of potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione?
potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione has a molecular weight of 225.28 g/mol, XLogP of -2.68, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazolidine-3-thione is sourced from PubChem (CID 173129835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).