C16H13ClN6O — CID 173130052
4-chloro-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzohydrazide (PubChem CID 173130052) has the molecular formula C16H13ClN6O and a molecular weight of 340.77 g/mol. Its IUPAC name is 4-chloro-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzohydrazide.
| Compound Name | 4-chloro-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzohydrazide |
|---|---|
| PubChem CID | 173130052 |
| Molecular Formula | C16H13ClN6O |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-chloro-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzohydrazide |
| SMILES | NNC(=O)c1ccc(Cl)c(Nc2nccc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C16H13ClN6O/c17-12-4-3-10(15(24)23-18)8-14(12)22-16-20-7-5-13(21-16)11-2-1-6-19-9-11/h1-9H,18H2,(H,23,24)(H,20,21,22) |
| InChIKey | BJXUOMVBOKEXQG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|