About lithium;ditert-butylphosphane;hydride
lithium;ditert-butylphosphane;hydride (PubChem CID 173130182) has the molecular formula C8H20LiP
and a molecular weight of 154.16 g/mol. Its IUPAC name is lithium;ditert-butylphosphane;hydride.
Molecular Properties
| Compound Name | lithium;ditert-butylphosphane;hydride |
| PubChem CID | 173130182 |
| Molecular Formula | C8H20LiP |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | lithium;ditert-butylphosphane;hydride |
| SMILES | CC(C)(C)PC(C)(C)C.[H-].[Li+] |
| InChI | InChI=1S/C8H19P.Li.H/c1-7(2,3)9-8(4,5)6;;/h9H,1-6H3;;/q;+1;-1 |
| InChIKey | FWQMENFFHQFIMM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;ditert-butylphosphane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ditert-butylphosphane;hydride?
The IUPAC name of lithium;ditert-butylphosphane;hydride (CID 173130182) is lithium;ditert-butylphosphane;hydride.
What is the SMILES notation for lithium;ditert-butylphosphane;hydride?
The canonical SMILES for lithium;ditert-butylphosphane;hydride is CC(C)(C)PC(C)(C)C.[H-].[Li+].
What is the InChIKey of lithium;ditert-butylphosphane;hydride?
The InChIKey is FWQMENFFHQFIMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19P.Li.H/c1-7(2,3)9-8(4,5)6;;/h9H,1-6H3;;/q;+1;-1.
What are the key properties of lithium;ditert-butylphosphane;hydride?
lithium;ditert-butylphosphane;hydride has a molecular weight of 154.16 g/mol, XLogP of 0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ditert-butylphosphane;hydride is sourced from PubChem (CID 173130182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).