About 1-(2-hexoxyethoxy)ethyl formate
1-(2-hexoxyethoxy)ethyl formate (PubChem CID 173130576) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 1-(2-hexoxyethoxy)ethyl formate.
Molecular Properties
| Compound Name | 1-(2-hexoxyethoxy)ethyl formate |
| PubChem CID | 173130576 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-(2-hexoxyethoxy)ethyl formate |
| SMILES | CCCCCCOCCOC(C)OC=O |
| InChI | InChI=1S/C11H22O4/c1-3-4-5-6-7-13-8-9-14-11(2)15-10-12/h10-11H,3-9H2,1-2H3 |
| InChIKey | DTUMQIDENPAWMZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hexoxyethoxy)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hexoxyethoxy)ethyl formate?
The IUPAC name of 1-(2-hexoxyethoxy)ethyl formate (CID 173130576) is 1-(2-hexoxyethoxy)ethyl formate.
What is the SMILES notation for 1-(2-hexoxyethoxy)ethyl formate?
The canonical SMILES for 1-(2-hexoxyethoxy)ethyl formate is CCCCCCOCCOC(C)OC=O.
What is the InChIKey of 1-(2-hexoxyethoxy)ethyl formate?
The InChIKey is DTUMQIDENPAWMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-3-4-5-6-7-13-8-9-14-11(2)15-10-12/h10-11H,3-9H2,1-2H3.
What are the key properties of 1-(2-hexoxyethoxy)ethyl formate?
1-(2-hexoxyethoxy)ethyl formate has a molecular weight of 218.29 g/mol, XLogP of 2.12, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hexoxyethoxy)ethyl formate is sourced from PubChem (CID 173130576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).