C28H51NO4 — CID 173131029
N-[1,3-bis(oxan-2-yl)butyl]-1,3-bis(oxan-2-yl)butan-1-amine (PubChem CID 173131029) has the molecular formula C28H51NO4 and a molecular weight of 465.72 g/mol. Its IUPAC name is N-[1,3-bis(oxan-2-yl)butyl]-1,3-bis(oxan-2-yl)butan-1-amine.
| Compound Name | N-[1,3-bis(oxan-2-yl)butyl]-1,3-bis(oxan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 173131029 |
| Molecular Formula | C28H51NO4 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.38 |
| IUPAC Name | N-[1,3-bis(oxan-2-yl)butyl]-1,3-bis(oxan-2-yl)butan-1-amine |
| SMILES | CC(CC(NC(CC(C)C1CCCCO1)C1CCCCO1)C1CCCCO1)C1CCCCO1 |
| InChI | InChI=1S/C28H51NO4/c1-21(25-11-3-7-15-30-25)19-23(27-13-5-9-17-32-27)29-24(28-14-6-10-18-33-28)20-22(2)26-12-4-8-16-31-26/h21-29H,3-20H2,1-2H3 |
| InChIKey | WCPXJLGFBHLNTF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |