C35H60N4O5SSi3 — CID 173131047
N,N-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[2-(1-trimethoxysilylpropyl)-1,3-benzothiazol-6-yl]diazenyl]aniline (PubChem CID 173131047) has the molecular formula C35H60N4O5SSi3 and a molecular weight of 733.21 g/mol. Its IUPAC name is N,N-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[2-(1-trimethoxysilylpropyl)-1,3-benzothiazol-6-yl]diazenyl]aniline.
| Compound Name | N,N-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[2-(1-trimethoxysilylpropyl)-1,3-benzothiazol-6-yl]diazenyl]aniline |
|---|---|
| PubChem CID | 173131047 |
| Molecular Formula | C35H60N4O5SSi3 |
| Molecular Weight | 733.21 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | N,N-bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[[2-(1-trimethoxysilylpropyl)-1,3-benzothiazol-6-yl]diazenyl]aniline |
| SMILES | CCC(c1nc2ccc(/N=N/c3ccc(N(CCO[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C)cc3)cc2s1)[Si](OC)(OC)OC |
| InChI | InChI=1S/C35H60N4O5SSi3/c1-15-32(48(40-8,41-9)42-10)33-36-30-21-18-28(26-31(30)45-33)38-37-27-16-19-29(20-17-27)39(22-24-43-46(11,12)34(2,3)4)23-25-44-47(13,14)35(5,6)7/h16-21,26,32H,15,22-25H2,1-14H3/b38-37+ |
| InChIKey | SAOWAZWNVFGCHH-HEFFKOSUSA-N |
| XLogP | 10.47 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.21 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|