C14H22AlN3O5P+ — CID 173131150
alumane;ethoxy-hydroxy-oxophosphanium;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 173131150) has the molecular formula C14H22AlN3O5P+ and a molecular weight of 370.30 g/mol. Its IUPAC name is alumane;ethoxy-hydroxy-oxophosphanium;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | alumane;ethoxy-hydroxy-oxophosphanium;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 173131150 |
| Molecular Formula | C14H22AlN3O5P+ |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | alumane;ethoxy-hydroxy-oxophosphanium;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCO[P+](=O)O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.[AlH3] |
| InChI | InChI=1S/C12H13N3O2.C2H5O3P.Al.3H/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-2-5-6(3)4;;;;/h7H,1-6H2;2H2,1H3;;;;/p+1 |
| InChIKey | YNICXMBUDXOVBA-UHFFFAOYSA-O |
| XLogP | -1.33 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|