C20H29F6N3O — CID 173131448
1-butyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-di(propan-2-yl)guanidine (PubChem CID 173131448) has the molecular formula C20H29F6N3O and a molecular weight of 441.46 g/mol. Its IUPAC name is 1-butyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-di(propan-2-yl)guanidine.
| Compound Name | 1-butyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 173131448 |
| Molecular Formula | C20H29F6N3O |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-butyl-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3,3-di(propan-2-yl)guanidine |
| SMILES | [H]/N=C(/N(CCCC)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H29F6N3O/c1-6-7-12-28(17(27)29(13(2)3)14(4)5)16-10-8-15(9-11-16)18(30,19(21,22)23)20(24,25)26/h8-11,13-14,27,30H,6-7,12H2,1-5H3/b27-17- |
| InChIKey | XHEGVMGTVWPXOQ-PKAZHMFMSA-N |
| XLogP | 5.66 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|