About sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride
sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride (PubChem CID 173131761) has the molecular formula C18H17ClN2NaO5PS
and a molecular weight of 462.83 g/mol. Its IUPAC name is sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride.
Molecular Properties
| Compound Name | sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride |
| PubChem CID | 173131761 |
| Molecular Formula | C18H17ClN2NaO5PS |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride |
| SMILES | O=P(O)(CNS(=O)(=O)c1ccc(-c2ccccc2)cc1)Oc1cccnc1Cl.[H-].[Na+] |
| InChI | InChI=1S/C18H16ClN2O5PS.Na.H/c19-18-17(7-4-12-20-18)26-27(22,23)13-21-28(24,25)16-10-8-15(9-11-16)14-5-2-1-3-6-14;;/h1-12,21H,13H2,(H,22,23);;/q;+1;-1 |
| InChIKey | FQCOQRNIDVSCSI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride?
The IUPAC name of sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride (CID 173131761) is sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride.
What is the SMILES notation for sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride?
The canonical SMILES for sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride is O=P(O)(CNS(=O)(=O)c1ccc(-c2ccccc2)cc1)Oc1cccnc1Cl.[H-].[Na+].
What is the InChIKey of sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride?
The InChIKey is FQCOQRNIDVSCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN2O5PS.Na.H/c19-18-17(7-4-12-20-18)26-27(22,23)13-21-28(24,25)16-10-8-15(9-11-16)14-5-2-1-3-6-14;;/h1-12,21H,13H2,(H,22,23);;/q;+1;-1.
What are the key properties of sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride?
sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride has a molecular weight of 462.83 g/mol, XLogP of 1.02, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(2-chloro-3-pyridinyl)oxy-[[(4-phenylphenyl)sulfonylamino]methyl]phosphinic acid;hydride is sourced from PubChem (CID 173131761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).