About 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine
5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 17313189) has the molecular formula C24H27FN6O2
and a molecular weight of 450.52 g/mol. Its IUPAC name is 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| PubChem CID | 17313189 |
| Molecular Formula | C24H27FN6O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Fc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27FN6O2/c25-22-17-26-24(28-19-3-7-21(8-4-19)31-11-15-33-16-12-31)29-23(22)27-18-1-5-20(6-2-18)30-9-13-32-14-10-30/h1-8,17H,9-16H2,(H2,26,27,28,29) |
| InChIKey | JBFURUYKCUIPSR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (CID 17313189) is 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine is Fc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1ccc(N2CCOCC2)cc1.
What is the InChIKey of 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine?
The InChIKey is JBFURUYKCUIPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27FN6O2/c25-22-17-26-24(28-19-3-7-21(8-4-19)31-11-15-33-16-12-31)29-23(22)27-18-1-5-20(6-2-18)30-9-13-32-14-10-30/h1-8,17H,9-16H2,(H2,26,27,28,29).
What are the key properties of 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine?
5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine has a molecular weight of 450.52 g/mol, XLogP of 3.78, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-N,4-N-bis(4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 17313189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).