About 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol
1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol (PubChem CID 173132142) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol |
| PubChem CID | 173132142 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol |
| SMILES | CC(C)(C)CCCC(O)C1=CCCC=C1 |
| InChI | InChI=1S/C14H24O/c1-14(2,3)11-7-10-13(15)12-8-5-4-6-9-12/h5,8-9,13,15H,4,6-7,10-11H2,1-3H3 |
| InChIKey | LNIQLKQKFFOYCX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol (CID 173132142) is 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol is CC(C)(C)CCCC(O)C1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol?
The InChIKey is LNIQLKQKFFOYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O/c1-14(2,3)11-7-10-13(15)12-8-5-4-6-9-12/h5,8-9,13,15H,4,6-7,10-11H2,1-3H3.
What are the key properties of 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol?
1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol has a molecular weight of 208.34 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yl-5,5-dimethylhexan-1-ol is sourced from PubChem (CID 173132142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).