About 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde
2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde (PubChem CID 173132179) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde |
| PubChem CID | 173132179 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde |
| SMILES | C=CCN1C=CN(CC=C)C1CC=O |
| InChI | InChI=1S/C11H16N2O/c1-3-6-12-8-9-13(7-4-2)11(12)5-10-14/h3-4,8-11H,1-2,5-7H2 |
| InChIKey | RWDJSLOXMNMLLW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde?
The IUPAC name of 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde (CID 173132179) is 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde.
What is the SMILES notation for 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde?
The canonical SMILES for 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde is C=CCN1C=CN(CC=C)C1CC=O.
What is the InChIKey of 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde?
The InChIKey is RWDJSLOXMNMLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-3-6-12-8-9-13(7-4-2)11(12)5-10-14/h3-4,8-11H,1-2,5-7H2.
What are the key properties of 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde?
2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde has a molecular weight of 192.26 g/mol, XLogP of 1.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl]acetaldehyde is sourced from PubChem (CID 173132179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).