C15H20F3NO2 — CID 173132867
1,1,1-trifluoro-4-[3-(2-hydroxyiminoethyl)phenyl]-2,4-dimethylpentan-2-ol (PubChem CID 173132867) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[3-(2-hydroxyiminoethyl)phenyl]-2,4-dimethylpentan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-[3-(2-hydroxyiminoethyl)phenyl]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 173132867 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1,1,1-trifluoro-4-[3-(2-hydroxyiminoethyl)phenyl]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)(CC(C)(O)C(F)(F)F)c1cccc(CC=NO)c1 |
| InChI | InChI=1S/C15H20F3NO2/c1-13(2,10-14(3,20)15(16,17)18)12-6-4-5-11(9-12)7-8-19-21/h4-6,8-9,20-21H,7,10H2,1-3H3 |
| InChIKey | GABXBZOJJHOPIP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|