C20H26SiTi — CID 173133140
bis(2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl)-dimethylsilane;titanium(2+) (PubChem CID 173133140) has the molecular formula C20H26SiTi and a molecular weight of 342.38 g/mol. Its IUPAC name is bis(2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl)-dimethylsilane;titanium(2+).
| Compound Name | bis(2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl)-dimethylsilane;titanium(2+) |
|---|---|
| PubChem CID | 173133140 |
| Molecular Formula | C20H26SiTi |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | bis(2,3,3a,7a-tetrahydro-1H-inden-3-id-2-yl)-dimethylsilane;titanium(2+) |
| SMILES | C[Si](C)(C1[CH-]C2C=CC=CC2C1)C1[CH-]C2C=CC=CC2C1.[Ti+2] |
| InChI | InChI=1S/C20H26Si.Ti/c1-21(2,19-11-15-7-3-4-8-16(15)12-19)20-13-17-9-5-6-10-18(17)14-20;/h3-11,13,15-20H,12,14H2,1-2H3;/q-2;+2 |
| InChIKey | NVBFIEZEUNGUIA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|