About [methyl(propyl)silyl] 2-(dimethoxyamino)acetate
[methyl(propyl)silyl] 2-(dimethoxyamino)acetate (PubChem CID 173133338) has the molecular formula C8H19NO4Si
and a molecular weight of 221.33 g/mol. Its IUPAC name is [methyl(propyl)silyl] 2-(dimethoxyamino)acetate.
Molecular Properties
| Compound Name | [methyl(propyl)silyl] 2-(dimethoxyamino)acetate |
| PubChem CID | 173133338 |
| Molecular Formula | C8H19NO4Si |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [methyl(propyl)silyl] 2-(dimethoxyamino)acetate |
| SMILES | CCC[SiH](C)OC(=O)CN(OC)OC |
| InChI | InChI=1S/C8H19NO4Si/c1-5-6-14(4)13-8(10)7-9(11-2)12-3/h14H,5-7H2,1-4H3 |
| InChIKey | WRHUEMNGRMVLPG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [methyl(propyl)silyl] 2-(dimethoxyamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(propyl)silyl] 2-(dimethoxyamino)acetate?
The IUPAC name of [methyl(propyl)silyl] 2-(dimethoxyamino)acetate (CID 173133338) is [methyl(propyl)silyl] 2-(dimethoxyamino)acetate.
What is the SMILES notation for [methyl(propyl)silyl] 2-(dimethoxyamino)acetate?
The canonical SMILES for [methyl(propyl)silyl] 2-(dimethoxyamino)acetate is CCC[SiH](C)OC(=O)CN(OC)OC.
What is the InChIKey of [methyl(propyl)silyl] 2-(dimethoxyamino)acetate?
The InChIKey is WRHUEMNGRMVLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO4Si/c1-5-6-14(4)13-8(10)7-9(11-2)12-3/h14H,5-7H2,1-4H3.
What are the key properties of [methyl(propyl)silyl] 2-(dimethoxyamino)acetate?
[methyl(propyl)silyl] 2-(dimethoxyamino)acetate has a molecular weight of 221.33 g/mol, XLogP of 0.72, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(propyl)silyl] 2-(dimethoxyamino)acetate is sourced from PubChem (CID 173133338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).