C11H13N5 — CID 173133421
6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 173133421) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 173133421 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 6-pyrrolidin-1-ylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2cnc(N3CCCC3)cc12 |
| InChI | InChI=1S/C11H13N5/c12-11-8-5-10(16-3-1-2-4-16)13-6-9(8)14-7-15-11/h5-7H,1-4H2,(H2,12,14,15) |
| InChIKey | UETPJMDRXQLGDQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |