C19H26N2O3 — CID 173134164
[(2R,4aR,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] imidazole-1-carboxylate (PubChem CID 173134164) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is [(2R,4aR,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] imidazole-1-carboxylate.
| Compound Name | [(2R,4aR,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 173134164 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [(2R,4aR,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] imidazole-1-carboxylate |
| SMILES | C=C(C)C1CC[C@@H](C)[C@]2(O)C[C@@H](OC(=O)n3ccnc3)C(C)=C[C@H]12 |
| InChI | InChI=1S/C19H26N2O3/c1-12(2)15-6-5-14(4)19(23)10-17(13(3)9-16(15)19)24-18(22)21-8-7-20-11-21/h7-9,11,14-17,23H,1,5-6,10H2,2-4H3/t14-,15?,16-,17-,19-/m1/s1 |
| InChIKey | FRWUFBHYAWVVFR-IOSDJTKYSA-N |
| XLogP | 3.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|