C18H25F3O3 — CID 173134237
[(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 3,3,3-trifluoropropanoate (PubChem CID 173134237) has the molecular formula C18H25F3O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 3,3,3-trifluoropropanoate.
| Compound Name | [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 173134237 |
| Molecular Formula | C18H25F3O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] 3,3,3-trifluoropropanoate |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@]2(O)C[C@@H](OC(=O)CC(F)(F)F)C(C)=C[C@@H]12 |
| InChI | InChI=1S/C18H25F3O3/c1-10(2)13-6-5-12(4)17(23)8-15(11(3)7-14(13)17)24-16(22)9-18(19,20)21/h7,12-15,23H,1,5-6,8-9H2,2-4H3/t12-,13+,14+,15-,17-/m1/s1 |
| InChIKey | HNNWGDVXIUNRMJ-RUCLQGLUSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|