C16H24O3 — CID 173134417
[(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] formate (PubChem CID 173134417) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] formate.
| Compound Name | [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] formate |
|---|---|
| PubChem CID | 173134417 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(2R,4aS,5R,8R,8aR)-8a-hydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] formate |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@]2(O)C[C@@H](OC=O)C(C)=C[C@@H]12 |
| InChI | InChI=1S/C16H24O3/c1-10(2)13-6-5-12(4)16(18)8-15(19-9-17)11(3)7-14(13)16/h7,9,12-15,18H,1,5-6,8H2,2-4H3/t12-,13+,14+,15-,16-/m1/s1 |
| InChIKey | OTNYYRPZZQBYFL-LYYZXLFJSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|