About 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid
2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid (PubChem CID 173134575) has the molecular formula C11H22O3Si
and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid.
Molecular Properties
| Compound Name | 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid |
| PubChem CID | 173134575 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid |
| SMILES | C[SiH](C)OC(CC=CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H22O3Si/c1-11(2,3)8-6-7-9(10(12)13)14-15(4)5/h6,8-9,15H,7H2,1-5H3,(H,12,13) |
| InChIKey | LUDVGWSLOUBGOR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid?
The IUPAC name of 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid (CID 173134575) is 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid.
What is the SMILES notation for 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid?
The canonical SMILES for 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid is C[SiH](C)OC(CC=CC(C)(C)C)C(=O)O.
What is the InChIKey of 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid?
The InChIKey is LUDVGWSLOUBGOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3Si/c1-11(2,3)8-6-7-9(10(12)13)14-15(4)5/h6,8-9,15H,7H2,1-5H3,(H,12,13).
What are the key properties of 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid?
2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid has a molecular weight of 230.38 g/mol, XLogP of 2.43, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsilyloxy-6,6-dimethylhept-4-enoic acid is sourced from PubChem (CID 173134575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).