C19H30O5 — CID 173134582
2-[(1R,4R,4aR,6R,8aS)-6-acetyloxy-4a-hydroxy-4,7-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl]propyl acetate (PubChem CID 173134582) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-[(1R,4R,4aR,6R,8aS)-6-acetyloxy-4a-hydroxy-4,7-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl]propyl acetate.
| Compound Name | 2-[(1R,4R,4aR,6R,8aS)-6-acetyloxy-4a-hydroxy-4,7-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl]propyl acetate |
|---|---|
| PubChem CID | 173134582 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[(1R,4R,4aR,6R,8aS)-6-acetyloxy-4a-hydroxy-4,7-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl]propyl acetate |
| SMILES | CC(=O)OCC(C)[C@H]1CC[C@@H](C)[C@]2(O)C[C@@H](OC(C)=O)C(C)=C[C@H]12 |
| InChI | InChI=1S/C19H30O5/c1-11-8-17-16(12(2)10-23-14(4)20)7-6-13(3)19(17,22)9-18(11)24-15(5)21/h8,12-13,16-18,22H,6-7,9-10H2,1-5H3/t12?,13-,16-,17-,18-,19-/m1/s1 |
| InChIKey | YYRIRBZKMFSNRG-AWHRIUEPSA-N |
| XLogP | 2.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|